Carboxylic acids and derivatives
Filtered Search Results
2-(Dimethylamino)ethyl methacrylate, 97%, stab. with ca 0.2% 4-methoxyphenol
CAS: 2867-47-2 Molecular Formula: C8H15NO2 Molecular Weight (g/mol): 157.213 MDL Number: MFCD00008589 InChI Key: JKNCOURZONDCGV-UHFFFAOYSA-N Synonym: 2-dimethylamino ethyl methacrylate,dimethylaminoethyl methacrylate,ageflex fm-1,dmaema,usaf rh-3,2-propenoic acid, 2-methyl-, 2-dimethylamino ethyl ester,2-n,n-dimethylamino ethyl methacrylate,n,n-dimethylaminoethyl methacrylate,2-dimethylaminoethyl methacrylate,n,n-dimethylethanolamine methacrylate PubChem CID: 17869 IUPAC Name: 2-(dimethylamino)ethyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCCN(C)C
| PubChem CID | 17869 |
|---|---|
| CAS | 2867-47-2 |
| Molecular Weight (g/mol) | 157.213 |
| MDL Number | MFCD00008589 |
| SMILES | CC(=C)C(=O)OCCN(C)C |
| Synonym | 2-dimethylamino ethyl methacrylate,dimethylaminoethyl methacrylate,ageflex fm-1,dmaema,usaf rh-3,2-propenoic acid, 2-methyl-, 2-dimethylamino ethyl ester,2-n,n-dimethylamino ethyl methacrylate,n,n-dimethylaminoethyl methacrylate,2-dimethylaminoethyl methacrylate,n,n-dimethylethanolamine methacrylate |
| IUPAC Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate |
| InChI Key | JKNCOURZONDCGV-UHFFFAOYSA-N |
| Molecular Formula | C8H15NO2 |
Vinyl acetate, 99%, stab. with 8-12ppm hydroquinone
CAS: 108-05-4 Molecular Formula: C4H6O2 Molecular Weight (g/mol): 86.09 MDL Number: MFCD00008713 InChI Key: XTXRWKRVRITETP-UHFFFAOYSA-N Synonym: vinyl acetate,acetic acid ethenyl ester,acetic acid vinyl ester,ethenyl ethanoate,1-acetoxyethylene,vinyl ethanoate,acetoxyethene,vinylacetat,vinyl acetate monomer,vinyl a monomer PubChem CID: 7904 ChEBI: CHEBI:46916 IUPAC Name: ethenyl acetate SMILES: CC(=O)OC=C
| PubChem CID | 7904 |
|---|---|
| CAS | 108-05-4 |
| Molecular Weight (g/mol) | 86.09 |
| ChEBI | CHEBI:46916 |
| MDL Number | MFCD00008713 |
| SMILES | CC(=O)OC=C |
| Synonym | vinyl acetate,acetic acid ethenyl ester,acetic acid vinyl ester,ethenyl ethanoate,1-acetoxyethylene,vinyl ethanoate,acetoxyethene,vinylacetat,vinyl acetate monomer,vinyl a monomer |
| IUPAC Name | ethenyl acetate |
| InChI Key | XTXRWKRVRITETP-UHFFFAOYSA-N |
| Molecular Formula | C4H6O2 |
Hydroxypropyl methacrylate, mixture of isomers, 97+%, stab. with ca 0.02% 4-methoxyphenol
CAS: 27813-02-1 Molecular Formula: C7H12O3 Molecular Weight (g/mol): 144.17 MDL Number: MFCD00004536 InChI Key: ZMARGGQEAJXRFP-UHFFFAOYNA-N Synonym: 2-hydroxypropyl methacrylate,2-hydroxypropylmethacrylate,hpma,beta-hydroxypropyl methacrylate,acryester hp,2-hydroxypropyl 2-methylacrylate,poly 2-hydroxypropyl methacrylate,2-hydroxypropyl 2-methyl-2-propenoate,2-propenoic acid, 2-methyl-, 2-hydroxypropyl ester,2-hpma PubChem CID: 13539 ChEBI: CHEBI:53440 IUPAC Name: 2-hydroxypropyl 2-methylprop-2-enoate SMILES: CC(CO)OC(=O)C(C)=C
| PubChem CID | 13539 |
|---|---|
| CAS | 27813-02-1 |
| Molecular Weight (g/mol) | 144.17 |
| ChEBI | CHEBI:53440 |
| MDL Number | MFCD00004536 |
| SMILES | CC(CO)OC(=O)C(C)=C |
| Synonym | 2-hydroxypropyl methacrylate,2-hydroxypropylmethacrylate,hpma,beta-hydroxypropyl methacrylate,acryester hp,2-hydroxypropyl 2-methylacrylate,poly 2-hydroxypropyl methacrylate,2-hydroxypropyl 2-methyl-2-propenoate,2-propenoic acid, 2-methyl-, 2-hydroxypropyl ester,2-hpma |
| IUPAC Name | 2-hydroxypropyl 2-methylprop-2-enoate |
| InChI Key | ZMARGGQEAJXRFP-UHFFFAOYNA-N |
| Molecular Formula | C7H12O3 |
Methyl pyrrole-2-carboxylate, 97%, Thermo Scientific Chemicals
CAS: 1193-62-0 Molecular Formula: C6H7NO2 Molecular Weight (g/mol): 125.127 MDL Number: MFCD00817048 InChI Key: VONGYFFEWFJHNP-UHFFFAOYSA-N Synonym: methyl pyrrole-2-carboxylate,methyl 2-pyrrolecarboxylate,1h-pyrrole-2-carboxylic acid, methyl ester,unii-3beg2ck3lu,pyrrole-2-carboxylic acid methyl ester,methyl1h-pyrrole-2-carboxylate,3beg2ck3lu,1h-pyrrole-2-carboxylic acid,methyl ester,pubchem9141,acmc-1bsa1 PubChem CID: 136930 IUPAC Name: methyl 1H-pyrrole-2-carboxylate SMILES: COC(=O)C1=CC=CN1
| PubChem CID | 136930 |
|---|---|
| CAS | 1193-62-0 |
| Molecular Weight (g/mol) | 125.127 |
| MDL Number | MFCD00817048 |
| SMILES | COC(=O)C1=CC=CN1 |
| Synonym | methyl pyrrole-2-carboxylate,methyl 2-pyrrolecarboxylate,1h-pyrrole-2-carboxylic acid, methyl ester,unii-3beg2ck3lu,pyrrole-2-carboxylic acid methyl ester,methyl1h-pyrrole-2-carboxylate,3beg2ck3lu,1h-pyrrole-2-carboxylic acid,methyl ester,pubchem9141,acmc-1bsa1 |
| IUPAC Name | methyl 1H-pyrrole-2-carboxylate |
| InChI Key | VONGYFFEWFJHNP-UHFFFAOYSA-N |
| Molecular Formula | C6H7NO2 |
Succinic acid, disodium salt hexahydrate, 97%
CAS: 6106-21-4 Molecular Formula: C4H16Na2O10 Molecular Weight (g/mol): 270.142 InChI Key: ZBTUYCUNQBRXOR-UHFFFAOYSA-L Synonym: disodium succinate hexahydrate,sodium succinate hexahydrate,unii-u16qod6c4e,butanedioic acid, disodium salt, hexahydrate,disodium butanedioate hexahydrate,u16qod6c4e,disodium hexahydrate succinate,sodium succinate dibasic hexahydrate,butanedioic acid disodium salt,succinic acid disodium salt hexahydrate PubChem CID: 3083938 ChEBI: CHEBI:63686 IUPAC Name: disodium;butanedioate;hexahydrate SMILES: C(CC(=O)[O-])C(=O)[O-].O.O.O.O.O.O.[Na+].[Na+]
| PubChem CID | 3083938 |
|---|---|
| CAS | 6106-21-4 |
| Molecular Weight (g/mol) | 270.142 |
| ChEBI | CHEBI:63686 |
| SMILES | C(CC(=O)[O-])C(=O)[O-].O.O.O.O.O.O.[Na+].[Na+] |
| Synonym | disodium succinate hexahydrate,sodium succinate hexahydrate,unii-u16qod6c4e,butanedioic acid, disodium salt, hexahydrate,disodium butanedioate hexahydrate,u16qod6c4e,disodium hexahydrate succinate,sodium succinate dibasic hexahydrate,butanedioic acid disodium salt,succinic acid disodium salt hexahydrate |
| IUPAC Name | disodium;butanedioate;hexahydrate |
| InChI Key | ZBTUYCUNQBRXOR-UHFFFAOYSA-L |
| Molecular Formula | C4H16Na2O10 |
3-Methyl-2-oxobutanoic acid, sodium salt, 98+%
CAS: 3715-29-5 Molecular Formula: C5H7NaO3 Molecular Weight (g/mol): 138.1 MDL Number: MFCD00002581 InChI Key: WIQBZDCJCRFGKA-UHFFFAOYSA-M Synonym: sodium 3-methyl-2-oxobutanoate,ketovaline sodium salt,unii-5om3h751iu,butanoic acid, 3-methyl-2-oxo-, sodium salt,3-methyl-2-oxobutyric acid sodium salt,2-ketoisovaleric acid sodium salt,sodium 3-methyl-2-oxobutyrate,3-methyl-2-oxobutanoic acid sodium salt,sodium dimethylpyruvate,ketovaline sodium PubChem CID: 2724059 IUPAC Name: sodium;3-methyl-2-oxobutanoate SMILES: CC(C)C(=O)C(=O)[O-].[Na+]
| PubChem CID | 2724059 |
|---|---|
| CAS | 3715-29-5 |
| Molecular Weight (g/mol) | 138.1 |
| MDL Number | MFCD00002581 |
| SMILES | CC(C)C(=O)C(=O)[O-].[Na+] |
| Synonym | sodium 3-methyl-2-oxobutanoate,ketovaline sodium salt,unii-5om3h751iu,butanoic acid, 3-methyl-2-oxo-, sodium salt,3-methyl-2-oxobutyric acid sodium salt,2-ketoisovaleric acid sodium salt,sodium 3-methyl-2-oxobutyrate,3-methyl-2-oxobutanoic acid sodium salt,sodium dimethylpyruvate,ketovaline sodium |
| IUPAC Name | sodium;3-methyl-2-oxobutanoate |
| InChI Key | WIQBZDCJCRFGKA-UHFFFAOYSA-M |
| Molecular Formula | C5H7NaO3 |
Naproxen Sodium, USP, 98-102%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 26159-34-2 Molecular Formula: C14H13NaO3 Molecular Weight (g/mol): 252.25 MDL Number: MFCD00058507 InChI Key: CDBRNDSHEYLDJV-FVGYRXGTSA-M IUPAC Name: sodium (2S)-2-(6-methoxynaphthalen-2-yl)propanoate SMILES: [Na+].COC1=CC=C2C=C(C=CC2=C1)[C@H](C)C([O-])=O
| CAS | 26159-34-2 |
|---|---|
| Molecular Weight (g/mol) | 252.25 |
| MDL Number | MFCD00058507 |
| SMILES | [Na+].COC1=CC=C2C=C(C=CC2=C1)[C@H](C)C([O-])=O |
| IUPAC Name | sodium (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| InChI Key | CDBRNDSHEYLDJV-FVGYRXGTSA-M |
| Molecular Formula | C14H13NaO3 |
Methyl (S)-(-)-lactate, 97%
CAS: 27871-49-4 Molecular Formula: C4H8O3 Molecular Weight (g/mol): 104.11 MDL Number: MFCD00064265 InChI Key: LPEKGGXMPWTOCB-VKHMYHEASA-N Synonym: methyl s---lactate,methyl l-lactate,s-methyl lactate,--methyl l-lactate,s-lactic acid methyl ester,methyl 2s-2-hydroxypropanoate,--methyl lactate,methyl s-2-hydroxypropionate,propanoic acid, 2-hydroxy-, methyl ester, 2s,--lactic acid methyl ester PubChem CID: 94386 ChEBI: CHEBI:83222 IUPAC Name: methyl (2S)-2-hydroxypropanoate SMILES: COC(=O)[C@H](C)O
| PubChem CID | 94386 |
|---|---|
| CAS | 27871-49-4 |
| Molecular Weight (g/mol) | 104.11 |
| ChEBI | CHEBI:83222 |
| MDL Number | MFCD00064265 |
| SMILES | COC(=O)[C@H](C)O |
| Synonym | methyl s---lactate,methyl l-lactate,s-methyl lactate,--methyl l-lactate,s-lactic acid methyl ester,methyl 2s-2-hydroxypropanoate,--methyl lactate,methyl s-2-hydroxypropionate,propanoic acid, 2-hydroxy-, methyl ester, 2s,--lactic acid methyl ester |
| IUPAC Name | methyl (2S)-2-hydroxypropanoate |
| InChI Key | LPEKGGXMPWTOCB-VKHMYHEASA-N |
| Molecular Formula | C4H8O3 |
Methyl trifluoroacetate, 99%
CAS: 431-47-0 Molecular Formula: C3H3F3O2 Molecular Weight (g/mol): 128.05 MDL Number: MFCD00000417 InChI Key: VMVNZNXAVJHNDJ-UHFFFAOYSA-N Synonym: methyl trifluoroacetate,trifluoroacetic acid methyl ester,acetic acid, trifluoro-, methyl ester,methyltrifluoroacetate,2,2,2-trifluoromethylacetate,acetic acid, 2,2,2-trifluoro-, methyl ester,methyl trifluoracetate,tfamt,methyl triflouroacetate,pubchem12490 PubChem CID: 9893 IUPAC Name: methyl 2,2,2-trifluoroacetate SMILES: COC(=O)C(F)(F)F
| PubChem CID | 9893 |
|---|---|
| CAS | 431-47-0 |
| Molecular Weight (g/mol) | 128.05 |
| MDL Number | MFCD00000417 |
| SMILES | COC(=O)C(F)(F)F |
| Synonym | methyl trifluoroacetate,trifluoroacetic acid methyl ester,acetic acid, trifluoro-, methyl ester,methyltrifluoroacetate,2,2,2-trifluoromethylacetate,acetic acid, 2,2,2-trifluoro-, methyl ester,methyl trifluoracetate,tfamt,methyl triflouroacetate,pubchem12490 |
| IUPAC Name | methyl 2,2,2-trifluoroacetate |
| InChI Key | VMVNZNXAVJHNDJ-UHFFFAOYSA-N |
| Molecular Formula | C3H3F3O2 |
Gluconic acid, potassium salt, 99%
Molecular Formula: C6H11KO7 Molecular Weight (g/mol): 234.25 MDL Number: MFCD00064211 InChI Key: HLCFGWHYROZGBI-JJKGCWMISA-M Synonym: potassium gluconate,potassium d-gluconate,gluconic acid potassium salt,potassuril,kaon elixir,potassium 2r,3s,4r,5r-2,3,4,5,6-pentahydroxyhexanoate,katorin,potalium,potasoral,sirokal PubChem CID: 16760467 IUPAC Name: potassium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate SMILES: C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[K+]
| PubChem CID | 16760467 |
|---|---|
| Molecular Weight (g/mol) | 234.25 |
| MDL Number | MFCD00064211 |
| SMILES | C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[K+] |
| Synonym | potassium gluconate,potassium d-gluconate,gluconic acid potassium salt,potassuril,kaon elixir,potassium 2r,3s,4r,5r-2,3,4,5,6-pentahydroxyhexanoate,katorin,potalium,potasoral,sirokal |
| IUPAC Name | potassium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| InChI Key | HLCFGWHYROZGBI-JJKGCWMISA-M |
| Molecular Formula | C6H11KO7 |
Methyl chloroacetate, 99+%
CAS: 96-34-4 Molecular Formula: C3H5ClO2 Molecular Weight (g/mol): 108.521 MDL Number: MFCD00000931 InChI Key: QABLOFMHHSOFRJ-UHFFFAOYSA-N Synonym: methyl chloroacetate,chloroacetic acid methyl ester,methyl monochloroacetate,methyl chloroethanoate,acetic acid, chloro-, methyl ester,methyl monochloracetate,methyl alpha-chloroacetate,methylchloroacetate,unii-450vsb182i,ccris 7749 PubChem CID: 7295 IUPAC Name: methyl 2-chloroacetate SMILES: COC(=O)CCl
| PubChem CID | 7295 |
|---|---|
| CAS | 96-34-4 |
| Molecular Weight (g/mol) | 108.521 |
| MDL Number | MFCD00000931 |
| SMILES | COC(=O)CCl |
| Synonym | methyl chloroacetate,chloroacetic acid methyl ester,methyl monochloroacetate,methyl chloroethanoate,acetic acid, chloro-, methyl ester,methyl monochloracetate,methyl alpha-chloroacetate,methylchloroacetate,unii-450vsb182i,ccris 7749 |
| IUPAC Name | methyl 2-chloroacetate |
| InChI Key | QABLOFMHHSOFRJ-UHFFFAOYSA-N |
| Molecular Formula | C3H5ClO2 |
Sodium Ascorbate, USP, bioCERTIFIED™, 1 kg, Spectrum Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Methyl 1-cyclohexene-1-carboxylate, 98%
CAS: 18448-47-0 MDL Number: MFCD00001544 InChI Key: KXPWRCPEMHIZGU-UHFFFAOYSA-N Synonym: methyl 1-cyclohexene-1-carboxylate,methyl cyclohex-1-enecarboxylate,methyl 1-cyclohexenecarboxylate,methyl cyclohex-1-ene-1-carboxylate,1-cyclohexene-1-carboxylic acid, methyl ester,cyclohexenecarboxylic acid, methyl ester,cyclohexene-1-carboxylic acid methyl ester,methyl1-cyclohexene-1-carboxylate,pubchem11031,1-carbomethoxy cyclohexene PubChem CID: 87647 IUPAC Name: methyl cyclohexene-1-carboxylate SMILES: COC(=O)C1=CCCCC1
| PubChem CID | 87647 |
|---|---|
| CAS | 18448-47-0 |
| MDL Number | MFCD00001544 |
| SMILES | COC(=O)C1=CCCCC1 |
| Synonym | methyl 1-cyclohexene-1-carboxylate,methyl cyclohex-1-enecarboxylate,methyl 1-cyclohexenecarboxylate,methyl cyclohex-1-ene-1-carboxylate,1-cyclohexene-1-carboxylic acid, methyl ester,cyclohexenecarboxylic acid, methyl ester,cyclohexene-1-carboxylic acid methyl ester,methyl1-cyclohexene-1-carboxylate,pubchem11031,1-carbomethoxy cyclohexene |
| IUPAC Name | methyl cyclohexene-1-carboxylate |
| InChI Key | KXPWRCPEMHIZGU-UHFFFAOYSA-N |
Potassium formate, 96%, pract.
CAS: 590-29-4 Molecular Formula: CHKO2 Molecular Weight (g/mol): 84.12 MDL Number: MFCD00013100 InChI Key: WFIZEGIEIOHZCP-UHFFFAOYSA-M Synonym: potassium formate,formic acid potassium salt,formic acid, potassium salt,formic acid, k salt,hcook,mravencan draselny czech,hco2k,formic acid, potassium salt 1:1,potassium formira,64-18-6 parent PubChem CID: 2735122 ChEBI: CHEBI:63316 IUPAC Name: potassium;formate SMILES: C(=O)[O-].[K+]
| PubChem CID | 2735122 |
|---|---|
| CAS | 590-29-4 |
| Molecular Weight (g/mol) | 84.12 |
| ChEBI | CHEBI:63316 |
| MDL Number | MFCD00013100 |
| SMILES | C(=O)[O-].[K+] |
| Synonym | potassium formate,formic acid potassium salt,formic acid, potassium salt,formic acid, k salt,hcook,mravencan draselny czech,hco2k,formic acid, potassium salt 1:1,potassium formira,64-18-6 parent |
| IUPAC Name | potassium;formate |
| InChI Key | WFIZEGIEIOHZCP-UHFFFAOYSA-M |
| Molecular Formula | CHKO2 |
Methyl acetate, 99%, extra pure
CAS: 79-20-9 Molecular Formula: C3H6O2 Molecular Weight (g/mol): 74.08 MDL Number: MFCD00008711 InChI Key: KXKVLQRXCPHEJC-UHFFFAOYSA-N Synonym: tereton,devoton,acetic acid, methyl ester,methyl ethanoate,acetic acid methyl ester,methylacetat,acetate de methyle,methylacetaat,methyl acetic ester,octan metylu PubChem CID: 6584 ChEBI: CHEBI:77700 IUPAC Name: methyl acetate SMILES: CC(=O)OC
| PubChem CID | 6584 |
|---|---|
| CAS | 79-20-9 |
| Molecular Weight (g/mol) | 74.08 |
| ChEBI | CHEBI:77700 |
| MDL Number | MFCD00008711 |
| SMILES | CC(=O)OC |
| Synonym | tereton,devoton,acetic acid, methyl ester,methyl ethanoate,acetic acid methyl ester,methylacetat,acetate de methyle,methylacetaat,methyl acetic ester,octan metylu |
| IUPAC Name | methyl acetate |
| InChI Key | KXKVLQRXCPHEJC-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2 |